EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC1=C2C=C(C(C)C)CCC(C)C2CC1 |
| InChI | InChI=1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h9-11,14H,5-8H2,1-4H3 |
| InChIKey | HLXDFKWNOTZIEI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xanthium strumarium (ncbitaxon:318068) | - | PubMed (26858282) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guaia-4,6-diene (CHEBI:138049) has role plant metabolite (CHEBI:76924) |
| guaia-4,6-diene (CHEBI:138049) is a carbobicyclic compound (CHEBI:36785) |
| guaia-4,6-diene (CHEBI:138049) is a polycyclic olefin (CHEBI:35714) |
| guaia-4,6-diene (CHEBI:138049) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| 3,8-dimethyl-5-(propan-2-yl)-1,2,6,7,8,8a-hexahydroazulene |
| Synonym | Source |
|---|---|
| 5-isopropyl-3,8-dimethyl-1,2,6,7,8,8a-hexahydroazulene | ChEBI |
| UniProt Name | Source |
|---|---|
| guaia-4,6-diene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20225 | MetaCyc |
| Citations |
|---|