EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40 |
| Net Charge | 0 |
| Average Mass | 340.595 |
| Monoisotopic Mass | 340.31300 |
| SMILES | [H][C@@]12CC/C(C)=C/CC/C(C)=C/C[C@@]1(C)CC[C@]1([H])[C@@H](C(=C)C)CC[C@@]21C |
| InChI | InChI=1S/C25H40/c1-18(2)21-13-17-25(6)22(21)14-16-24(5)15-12-20(4)9-7-8-19(3)10-11-23(24)25/h8,12,21-23H,1,7,9-11,13-17H2,2-6H3/b19-8+,20-12+/t21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | JFQLHYSXZPELNV-LNYIGJDBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus stellatus (ncbitaxon:1549217) | - | PubMed (28673978) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stellata-2,6,19-triene (CHEBI:138048) has role fungal metabolite (CHEBI:76946) |
| stellata-2,6,19-triene (CHEBI:138048) is a carbotricyclic compound (CHEBI:38032) |
| stellata-2,6,19-triene (CHEBI:138048) is a polycyclic olefin (CHEBI:35714) |
| stellata-2,6,19-triene (CHEBI:138048) is a sesterterpene (CHEBI:35192) |
| IUPAC Name |
|---|
| (3S,3aR,5aR,7E,11E,14aR,14bR)-5a,8,12,14b-tetramethyl-3-(prop-1-en-2-yl)-1,2,3,3a,4,5,5a,6,9,10,13,14,14a,14b-tetradecahydrocycloundeca[e]indene |
| UniProt Name | Source |
|---|---|
| stellata-2,6,19-triene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-18553 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28601869 | Reaxys |
| Citations |
|---|