EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | CC1C=CC2(C(C)C)CC12 |
| InChI | InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | GJYKUZUTZNTBEC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma (ncbitaxon:99568) | tuber (BTO:0001400) | Article (Journal of Jiangxi Normal University(Natural Science), 2000, 24, 274-277) | |
| Pinus densiflora (ncbitaxon:77912) | amniotic fluid (BTO:0000068) | PubMed (15187434) | Isolated from the essential oil of the needles |
| Pleodendron costaricense (ncbitaxon:549616) | |||
| bark (BTO:0001301) | PubMed (16872133) | ||
| leaf (BTO:0000713) | PubMed (16872133) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-thujene (CHEBI:138047) has role plant metabolite (CHEBI:76924) |
| β-thujene (CHEBI:138047) is a polycyclic olefin (CHEBI:35714) |
| β-thujene (CHEBI:138047) is a thujene (CHEBI:50030) |
| IUPAC Name |
|---|
| 4-methyl-1-(propan-2-yl)bicyclo[3.1.0]hex-2-ene |
| UniProt Name | Source |
|---|---|
| β-thujene | UniProt |
| Citations |
|---|