EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | C/C1=C\C[C@H](C(C)(C)O)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C15H26O/c1-12-6-5-7-13(2)9-11-14(10-8-12)15(3,4)16/h6,9,14,16H,5,7-8,10-11H2,1-4H3/b12-6+,13-9+/t14-/m1/s1 |
| InChIKey | SDMLCXJKAYFHQM-MKJLVJGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia brevistyla (ncbitaxon:296050) | flower (BTO:0000469) | PubMed (26744017) | |
| Zingiber officinale (ncbitaxon:94328) | - | PubMed (23272109) | Isolated from the essential oil |
| Cymbopogon validus (IPNI:397032-1) | |||
| flower (BTO:0000469) | PubMed (27261849) | ||
| leaf (BTO:0000713) | PubMed (27261849) | ||
| Xanthocyparis vietnamensis (ncbitaxon:257623) | leaf (BTO:0000713) | PubMed (27355937) | |
| Citrus hystrix (ncbitaxon:170989) | leaf (BTO:0000713) | PubMed (28930124) | |
| Curcuma longa (ncbitaxon:136217) | - | PubMed (23272109) | Isolated from the essential oil |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,6E)-hedycaryol (CHEBI:138043) has role plant metabolite (CHEBI:76924) |
| (2E,6E)-hedycaryol (CHEBI:138043) has role volatile oil component (CHEBI:27311) |
| (2E,6E)-hedycaryol (CHEBI:138043) is a germacrane sesquiterpenoid (CHEBI:68588) |
| (2E,6E)-hedycaryol (CHEBI:138043) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 2-[(1R,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]propan-2-ol |
| Synonyms | Source |
|---|---|
| (1E,4E,7R)-germacra-1(10),4-dien-11-ol | ChEBI |
| (+)-hedycaryol | ChEBI |
| UniProt Name | Source |
|---|---|
| (2E,6E)-hedycaryol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20143 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2258683 | Reaxys |
| Citations |
|---|