EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:138042 - τ-cadinol
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12CCC(C)=C[C@@]1([H])[C@H](C(C)C)CC[C@]2(C)O |
| InChI | InChI=1S/C15H26O/c1-10(2)12-7-8-15(4,16)14-6-5-11(3)9-13(12)14/h9-10,12-14,16H,5-8H2,1-4H3/t12-,13-,14+,15-/m0/s1 |
| InChIKey | LHYHMMRYTDARSZ-XQLPTFJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Achillea distans (ncbitaxon:282733) | root (BTO:0001188) | PubMed (20432153) | |
| Alpinia rafflesiana (ncbitaxon:105680) | rhizome (BTO:0001181) | PubMed (24273875) | |
| Anaphalis contorta (ncbitaxon:1209452) | flower (BTO:0000469) | PubMed (23513735) | |
| Annona muricata (ncbitaxon:13337) | leaf (BTO:0000713) | PubMed (10.1080/10412905.2007.9699288) | |
| Baccharoides lilacina (IPNI:20008441-1) | aerial part (BTO:0001658) | PubMed (23678821) | |
| Bothriochloa alta (ncbitaxon:330548) | - | PubMed (10.1016/j.flora.2006.12.005) | |
| Cinnamomum perrottetii (ncbitaxon:1225868) | leaf (BTO:0000713) | PubMed (26453373) | |
| Cladanthus mixtus (ncbitaxon:179396) | |||
| aerial part (BTO:0001658) | PubMed (23157016) | ||
| - | PubMed (23157016) | ||
| Croton pulegiodorus (IPNI:323894-2) | - | PubMed (20645733) | |
| Eugenia brasiliensis (ncbitaxon:1231846) | leaf (BTO:0000713) | PubMed (19308653) | |
| Litsea acutivena (ncbitaxon:344083) | twig (BTO:0001411) | PubMed (22224304) | |
| Litsea coreana (ncbitaxon:126736) | leaf (BTO:0000713) | PubMed (21121272) | |
| Litsea linii (IPNI:465795-1) | twig (BTO:0001411) | PubMed (21213991) | |
| Litsea mushaensis (IPNI:465867-1) | leaf (BTO:0000713) | PubMed (21213991) | |
| Machilus philippinensis (ncbitaxon:337469) | leaf (BTO:0000713) | PubMed (20334154) | |
| Munnozia senecionidis (ncbitaxon:207900) | - | PubMed (19731606) | |
| Myrcianthes rhopaloides (IPNI:599293-1) | leaf (BTO:0000713) | PubMed (18649320) | |
| Neolitsea parvigemma (IPNI:467010-1) | leaf (BTO:0000713) | PubMed (21941915) | |
| Pulicaria stephanocarpa (ncbitaxon:557708) | leaf (BTO:0000713) | PubMed (22428262) | |
| Salvia aratocensis (IPNI:60438002-2) | - | PubMed (22224302) | |
| Uvaria ovata (IPNI:75874-1) | root (BTO:0001188) | PubMed (22224295) | |
| Xenophyllum poposum (ncbitaxon:462584) | - | PubMed (23413577) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| τ-cadinol (CHEBI:138042) has role plant metabolite (CHEBI:76924) |
| τ-cadinol (CHEBI:138042) has role volatile oil component (CHEBI:27311) |
| τ-cadinol (CHEBI:138042) is a cadinane sesquiterpenoid (CHEBI:22975) |
| τ-cadinol (CHEBI:138042) is a carbobicyclic compound (CHEBI:36785) |
| τ-cadinol (CHEBI:138042) is a octahydronaphthalenes (CHEBI:138397) |
| τ-cadinol (CHEBI:138042) is a tertiary alcohol (CHEBI:26878) |
| Synonyms | Source |
|---|---|
| Cedrelanol | ChemIDplus |
| epi-α-cadinol | ChEBI |
| epi-alpha-Cadinol | KNApSAcK |
| UniProt Name | Source |
|---|---|
| tau-cadinol | UniProt |
| Citations |
|---|