EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:138040 - 7-epi-α-eudesmol
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12C[C@@H](C(C)(C)O)CC[C@@]1(C)CCC=C2C |
| InChI | InChI=1S/C15H26O/c1-11-6-5-8-15(4)9-7-12(10-13(11)15)14(2,3)16/h6,12-13,16H,5,7-10H2,1-4H3/t12-,13-,15+/m0/s1 |
| InChIKey | FCSRUSQUAVXUKK-KCQAQPDRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cymbopogon distans (ncbitaxon:152208) | leaf (BTO:0000713) | DOI (10.1080/10412905.1996.9700577) | Isolated from the leaf oil |
| Callicarpa americana (ncbitaxon:204211) | - | PubMed (10898657) | Isolated from the essential oil |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-epi-α-eudesmol (CHEBI:138040) has role plant metabolite (CHEBI:76924) |
| 7-epi-α-eudesmol (CHEBI:138040) has role volatile oil component (CHEBI:27311) |
| 7-epi-α-eudesmol (CHEBI:138040) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| 7-epi-α-eudesmol (CHEBI:138040) is a octahydronaphthalenes (CHEBI:138397) |
| 7-epi-α-eudesmol (CHEBI:138040) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 2-[(2S,4aR,8aR)-4a,8-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-2-yl]propan-2-ol |
| Synonyms | Source |
|---|---|
| [2S-(2alpha,4abeta,8aalpha)]-1,2,3,4,4a,5,6,8a-Octahydro-alpha,alpha,4a,8-tetramethyl-2-naphthalenemethanol | KNApSAcK |
| 7-epi-alpha-Eudesmol | KNApSAcK |
| UniProt Name | Source |
|---|---|
| 7-epi-α-eudesmol | UniProt |
| Citations |
|---|