EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | C/C1=C\CC2(C)CCC(C)(C)C=C2CC/C(C)=C/CC1 |
| InChI | InChI=1S/C20H32/c1-16-7-6-8-17(2)11-12-20(5)14-13-19(3,4)15-18(20)10-9-16/h7,11,15H,6,8-10,12-14H2,1-5H3/b16-7+,17-11+ |
| InChIKey | KDEVGDLVYKBTQM-WPNGSOMFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (27933080) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E,7E)-dolathalia-3,7,11-triene (CHEBI:138039) has role plant metabolite (CHEBI:76924) |
| (3E,7E)-dolathalia-3,7,11-triene (CHEBI:138039) is a carbobicyclic compound (CHEBI:36785) |
| (3E,7E)-dolathalia-3,7,11-triene (CHEBI:138039) is a diterpene (CHEBI:35190) |
| (3E,7E)-dolathalia-3,7,11-triene (CHEBI:138039) is a polycyclic olefin (CHEBI:35714) |
| IUPAC Name |
|---|
| (7E,11E)-3,3,7,11,13a-pentamethy1-2,3,5,6,9,10,13,13a-octahydro-1H-benzo[11]annulene |
| UniProt Name | Source |
|---|---|
| (3E,7E)-dolathalia-3,7,11-triene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20110 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:129320436 | Reaxys |
| Citations |
|---|