EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H34N2O2 |
| Net Charge | 0 |
| Average Mass | 442.603 |
| Monoisotopic Mass | 442.26203 |
| SMILES | c1ccc(C(c2ccccc2)N2CCN(CCCC3(c4ccccc4)OCCO3)CC2)cc1 |
| InChI | InChI=1S/C29H34N2O2/c1-4-11-25(12-5-1)28(26-13-6-2-7-14-26)31-21-19-30(20-22-31)18-10-17-29(32-23-24-33-29)27-15-8-3-9-16-27/h1-9,11-16,28H,10,17-24H2 |
| InChIKey | LRMJAFKKJLRDLE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dotarizine (CHEBI:138033) has role calcium channel blocker (CHEBI:38215) |
| dotarizine (CHEBI:138033) has role serotonergic antagonist (CHEBI:48279) |
| dotarizine (CHEBI:138033) has role vasodilator agent (CHEBI:35620) |
| dotarizine (CHEBI:138033) is a N-alkylpiperazine (CHEBI:46845) |
| dotarizine (CHEBI:138033) is a cyclic ketal (CHEBI:59779) |
| dotarizine (CHEBI:138033) is a dioxolane (CHEBI:39430) |
| IUPAC Name |
|---|
| 1-(diphenylmethyl)-4-[3-(2-phenyl-1,3-dioxolan-2-yl)propyl]piperazine |
| INNs | Source |
|---|---|
| dotarizina | ChemIDplus |
| dotarizine | ChemIDplus |
| dotarizine | ChemIDplus |
| dotarizinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(Diphenylmethyl)-4-[3-(2-phenyl-1,3-dioxolan-2-yl)propyl]piperazin | SUBMITTER |
| FI-6026 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 49929 | ChemSpider |
| Dotarizine | Wikipedia |
| EP97340 | Patent |
| US4883797 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6879159 | Reaxys |
| CAS:84625-59-2 | ChemIDplus |
| Citations |
|---|