EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H34N2O2 |
| Net Charge | 0 |
| Average Mass | 442.603 |
| Monoisotopic Mass | 442.26203 |
| SMILES | c1ccc(C(c2ccccc2)N2CCN(CCCC3(c4ccccc4)OCCO3)CC2)cc1 |
| InChI | InChI=1S/C29H34N2O2/c1-4-11-25(12-5-1)28(26-13-6-2-7-14-26)31-21-19-30(20-22-31)18-10-17-29(32-23-24-33-29)27-15-8-3-9-16-27/h1-9,11-16,28H,10,17-24H2 |
| InChIKey | LRMJAFKKJLRDLE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dotarizine (CHEBI:138033) has role calcium channel blocker (CHEBI:38215) |
| dotarizine (CHEBI:138033) has role serotonergic antagonist (CHEBI:48279) |
| dotarizine (CHEBI:138033) has role vasodilator agent (CHEBI:35620) |
| dotarizine (CHEBI:138033) is a N-alkylpiperazine (CHEBI:46845) |
| dotarizine (CHEBI:138033) is a cyclic ketal (CHEBI:59779) |
| dotarizine (CHEBI:138033) is a dioxolane (CHEBI:39430) |
| IUPAC Name |
|---|
| 1-(diphenylmethyl)-4-[3-(2-phenyl-1,3-dioxolan-2-yl)propyl]piperazine |
| INNs | Source |
|---|---|
| dotarizina | ChemIDplus |
| dotarizine | ChemIDplus |
| dotarizine | ChemIDplus |
| dotarizinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(Diphenylmethyl)-4-[3-(2-phenyl-1,3-dioxolan-2-yl)propyl]piperazin | SUBMITTER |
| FI-6026 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 49929 | ChemSpider |
| Dotarizine | Wikipedia |
| EP97340 | Patent |
| US4883797 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6879159 | Reaxys |
| CAS:84625-59-2 | ChemIDplus |
| Citations |
|---|