EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31N3O6 |
| Net Charge | 0 |
| Average Mass | 469.538 |
| Monoisotopic Mass | 469.22129 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)NCCCCNCCCNC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H31N3O6/c29-20-8-4-18(16-22(20)31)6-10-24(33)27-14-2-1-12-26-13-3-15-28-25(34)11-7-19-5-9-21(30)23(32)17-19/h4-11,16-17,26,29-32H,1-3,12-15H2,(H,27,33)(H,28,34)/b10-6+,11-7+ |
| InChIKey | OPJNODHFKFAIBH-JMQWPVDRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum melongena (ncbitaxon:4111) | - | Article (Book: The Aldrich Library of FT-IR Spectra. 1st edition, 1985, 1, 309D) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N1,N8-bis(caffeoyl)spermidine (CHEBI:138028) has functional parent trans-caffeic acid (CHEBI:16433) |
| N1,N8-bis(caffeoyl)spermidine (CHEBI:138028) has functional parent spermidine (CHEBI:16610) |
| N1,N8-bis(caffeoyl)spermidine (CHEBI:138028) has role plant metabolite (CHEBI:76924) |
| N1,N8-bis(caffeoyl)spermidine (CHEBI:138028) is a enamide (CHEBI:51751) |
| N1,N8-bis(caffeoyl)spermidine (CHEBI:138028) is a polyphenol (CHEBI:26195) |
| N1,N8-bis(caffeoyl)spermidine (CHEBI:138028) is a secondary amino compound (CHEBI:50995) |
| N1,N8-bis(caffeoyl)spermidine (CHEBI:138028) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2E)-3-(3,4-dihydroxyphenyl)-N-{3-[(4-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino}butyl)amino]propyl}prop-2-enamide |
| Synonym | Source |
|---|---|
| dicaffeoylspermidine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00054011 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:124935-80-4 | ChemIDplus |