EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H41FN4O12 |
| Net Charge | 0 |
| Average Mass | 668.672 |
| Monoisotopic Mass | 668.27050 |
| SMILES | COC(=O)CC[C@H](NC(=O)[C@H](CC(=O)OC)NC(=O)OCc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)OC)C(=O)CF)C(C)C |
| InChI | InChI=1S/C30H41FN4O12/c1-17(2)26(29(42)33-20(22(36)15-31)13-24(38)45-4)35-27(40)19(11-12-23(37)44-3)32-28(41)21(14-25(39)46-5)34-30(43)47-16-18-9-7-6-8-10-18/h6-10,17,19-21,26H,11-16H2,1-5H3,(H,32,41)(H,33,42)(H,34,43)(H,35,40)/t19-,20-,21-,26-/m0/s1 |
| InChIKey | GBJVAVGBSGRRKN-JYEBCORGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.4.22.56 (caspase-3) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of caspase-3 (EC 3.4.22.56). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Z-DEVD-FMK (CHEBI:138013) has role apoptosis inhibitor (CHEBI:68494) |
| Z-DEVD-FMK (CHEBI:138013) has role EC 3.4.22.56 (caspase-3) inhibitor (CHEBI:138014) |
| Z-DEVD-FMK (CHEBI:138013) has role neuroprotective agent (CHEBI:63726) |
| Z-DEVD-FMK (CHEBI:138013) is a tetrapeptide (CHEBI:48030) |
| Synonyms | Source |
|---|---|
| benzyloxycarbonyl-Asp-Glu-Val-Asp-fluoromethylketone | ChEBI |
| benzyloxycarbonyl-Asp(OMe)-Glu(OMe)-Val-Asp(OMe)-fluoromethylketone | ChEBI |
| N-[(phenylmethoxy)carbonyl]-L-α-aspartyl-L-α-glutamyl-N-[(1S)-3-fluoro-1-(2-methoxy-2-oxoethyl)-2-oxopropyl]-L-valinamide, 1,2-dimethyl ester | ChEBI |
| methyl (4S)-5-{[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]amino}-4-{[(2S)-2-{[(benzyloxy)carbonyl]amino}-4-methoxy-4-oxobutanoyl]amino}-5-oxopentanoate | ChEBI |
| methyl (5S,8S,11S,14S)-14-(fluoroacetyl)-11-isopropyl-5-(2-methoxy-2-oxoethyl)-8-(3-methoxy-3-oxopropyl)-3,6,9,12-tetraoxo-1-phenyl-2-oxa-4,7,10,13-tetraazahexadecan-16-oate | ChEBI |
| specific inhibitor of caspase-3 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9977166 | Reaxys |
| Citations |
|---|