EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17ClN2O4 |
| Net Charge | 0 |
| Average Mass | 372.808 |
| Monoisotopic Mass | 372.08768 |
| SMILES | CCOC(=O)[C@@H](C)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C19H17ClN2O4/c1-3-24-19(23)12(2)25-14-5-7-15(8-6-14)26-18-11-21-17-10-13(20)4-9-16(17)22-18/h4-12H,3H2,1-2H3/t12-/m1/s1 |
| InChIKey | OSUHJPCHFDQAIT-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Applications: | proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quizalofop-P-ethyl (CHEBI:137938) has functional parent quizalofop-P (CHEBI:137507) |
| quizalofop-P-ethyl (CHEBI:137938) has role agrochemical (CHEBI:33286) |
| quizalofop-P-ethyl (CHEBI:137938) has role proherbicide (CHEBI:136646) |
| quizalofop-P-ethyl (CHEBI:137938) is a ethyl 2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate (CHEBI:137937) |
| quizalofop-P-ethyl (CHEBI:137938) is a quinoxaline herbicide (CHEBI:137504) |
| quizalofop-P-ethyl (CHEBI:137938) is enantiomer of (S)-quizalofop-ethyl (CHEBI:137939) |
| Incoming Relation(s) |
| quizalofop-ethyl (CHEBI:81807) has part quizalofop-P-ethyl (CHEBI:137938) |
| (S)-quizalofop-ethyl (CHEBI:137939) is enantiomer of quizalofop-P-ethyl (CHEBI:137938) |
| IUPAC Name |
|---|
| ethyl (2R)-2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate |
| Synonyms | Source |
|---|---|
| ethyl (2R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenoxy]propionate | Alan Wood's Pesticides |
| (+)-quizalofop-ethyl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| derivatives/quizalofop-p-ethyl | Alan Wood's Pesticides |
| 583 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9648298 | Reaxys |
| Reaxys:13263419 | Reaxys |
| CAS:100646-51-3 | Alan Wood's Pesticides |
| CAS:100646-51-3 | ChemIDplus |
| CAS:100646-51-3 | NIST Chemistry WebBook |
| Citations |
|---|