EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H37O5 |
| Net Charge | -1 |
| Average Mass | 405.555 |
| Monoisotopic Mass | 405.26465 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC(=O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)[O-])[C@]1([H])[C@@H](O)C2 |
| InChI | InChI=1S/C24H38O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-19,22,25-26H,4-12H2,1-3H3,(H,28,29)/p-1/t13-,14+,15-,16-,17+,18+,19+,22+,23+,24-/m1/s1 |
| InChIKey | MIHNUBCEFJLAGN-RAEYQWLJSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3α,7β-dihydroxy-12-oxo-5β-cholanate (CHEBI:137886) is a cholanic acid anion (CHEBI:131878) |
| 3α,7β-dihydroxy-12-oxo-5β-cholanate (CHEBI:137886) is conjugate base of 3α,7β-dihydroxy-12-oxo-5β-cholanic acid (CHEBI:138401) |
| Incoming Relation(s) |
| 3α,7β-dihydroxy-12-oxo-5β-cholanic acid (CHEBI:138401) is conjugate acid of 3α,7β-dihydroxy-12-oxo-5β-cholanate (CHEBI:137886) |
| IUPAC Name |
|---|
| 3α,7β-dihydroxy-12-oxo-5β-cholan-24-oate |
| Synonyms | Source |
|---|---|
| 12-ketoursodeoxycholate | ChEBI |
| 12-oxoursodeoxycholate | ChEBI |
| (3α,5β,7β)-3,7-dihydroxy-12-oxocholan-24-oate | IUPAC |
| UniProt Name | Source |
|---|---|
| 3 | UniProt |