EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:137823 - 9,14,19,19,19-pentadeuterio-1α,25-dihydroxyprevitamin D3
| Formula | C32H54O3 |
| Net Charge | 0 |
| Average Mass | 486.781 |
| Monoisotopic Mass | 486.40730 |
| SMILES | [H][C@]1([C@]([H])(C)CCCC(C)(C)O)CC[C@@]2(C)C(/C=C\C3=C(C(C)(C)C)[C@@H](O)C[C@H](O)C3)=C(C)CC[C@]12C |
| InChI | InChI=1S/C27H44O3/c1-18(8-6-14-26(3,4)30)23-12-13-24-20(9-7-15-27(23,24)5)10-11-21-16-22(28)17-25(29)19(21)2/h9-11,18,22-25,28-30H,6-8,12-17H2,1-5H3/b11-10-/t18-,22-,23-,24+,25+,27-/m1/s1/i2D3,9D,24D |
| InChIKey | DOIZGAFWGREMOD-SGWDTOPTSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,14,19,19,19-pentadeuterio-1α,25-dihydroxyprevitamin D3 (CHEBI:137823) is a vitamin D (CHEBI:27300) |
| Synonyms | Source |
|---|---|
| 9,14,19,19,19-pentadeuterio-1alpha,25-dihydroxyprecholecalciferol | LIPID MAPS |
| (6Z)-(1S,3R)-9,14,19,19,19-pentadeuterio-9,10-seco-5(10),6,8-cholestatriene-1,3,25-triol | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMST03020097 | LIPID MAPS |