EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46O2 |
| Net Charge | 0 |
| Average Mass | 426.685 |
| Monoisotopic Mass | 426.34978 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@]([H])(C)C/C=C(\OC=C)C(C)C |
| InChI | InChI=1S/C29H46O2/c1-7-31-27(19(2)3)13-8-20(4)24-11-12-25-23-10-9-21-18-22(30)14-16-28(21,5)26(23)15-17-29(24,25)6/h7,9,13,19-20,22-26,30H,1,8,10-12,14-18H2,2-6H3/b27-13-/t20-,22+,23+,24-,25+,26+,28+,29-/m1/s1 |
| InChIKey | PNAJLVVZORLZKN-JDOUOGMTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-vinyloxy-cholest-5,23Z-dien-3β-ol (CHEBI:137806) is a bile acid (CHEBI:3098) |
| Manual Xrefs | Databases |
|---|---|
| LMST01010285 | LIPID MAPS |