EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O3 |
| Net Charge | 0 |
| Average Mass | 418.662 |
| Monoisotopic Mass | 418.34470 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H]([C@H](C)CC[C@@H](O)C(C)C)CC[C@@]3([H])C1[C@H](O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C27H46O3/c1-16(2)23(29)9-6-17(3)20-7-8-21-25-22(11-13-27(20,21)5)26(4)12-10-19(28)14-18(26)15-24(25)30/h15-17,19-25,28-30H,6-14H2,1-5H3/t17-,19+,20-,21+,22+,23-,24-,25?,26+,27-/m1/s1 |
| InChIKey | ZNCHPOYZMVVJCK-DQESUHKRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24R-cholest-5-en-3β,7-α,24-triol (CHEBI:137805) is a bile acid (CHEBI:3098) |
| Synonym | Source |
|---|---|
| (24R)-Cholest-5-ene-3-beta,7-alpha,24-triol | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMST01010155 | LIPID MAPS |
| HMDB0011644 | HMDB |