EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:137794 - 10-fluoro-capric acid
| Formula | C10H19FO2 |
| Net Charge | 0 |
| Average Mass | 190.258 |
| Monoisotopic Mass | 190.13691 |
| SMILES | O=C(O)CCCCCCCCCF |
| InChI | InChI=1S/C10H19FO2/c11-9-7-5-3-1-2-4-6-8-10(12)13/h1-9H2,(H,12,13) |
| InChIKey | LXJHQFGNWFLQTR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-fluoro-capric acid (CHEBI:137794) is a fluoro fatty acid (CHEBI:60693) |
| 10-fluoro-capric acid (CHEBI:137794) is a medium-chain fatty acid (CHEBI:59554) |
| Synonyms | Source |
|---|---|
| 10-fluoro-decanoic acid | LIPID MAPS |
| 10:0(10F) | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01090047 | LIPID MAPS |