EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CCCCCCCCC/C=C\C=C\C(=O)CCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-17(19)15-13-16-18(20)21/h10-12,14H,2-9,13,15-16H2,1H3,(H,20,21)/b11-10-,14-12+ |
| InChIKey | YVWMHFYOIJMUMN-HSINTONASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (18287092) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6E,8Z)-5-oxooctadecadienoic acid (CHEBI:137754) has role human metabolite (CHEBI:77746) |
| (6E,8Z)-5-oxooctadecadienoic acid (CHEBI:137754) is a enone (CHEBI:51689) |
| (6E,8Z)-5-oxooctadecadienoic acid (CHEBI:137754) is a long-chain fatty acid (CHEBI:15904) |
| (6E,8Z)-5-oxooctadecadienoic acid (CHEBI:137754) is a octadecanoid (CHEBI:36326) |
| (6E,8Z)-5-oxooctadecadienoic acid (CHEBI:137754) is a oxo fatty acid (CHEBI:59644) |
| (6E,8Z)-5-oxooctadecadienoic acid (CHEBI:137754) is a polyunsaturated fatty acid (CHEBI:26208) |
| IUPAC Name |
|---|
| (6E,8Z)-5-oxooctadeca-6,8-dienoic acid |
| Synonyms | Source |
|---|---|
| 5-oxo-ODE | ChEBI |
| 5-oxo-(6E,8Z)-octadecadienoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15801994 | Reaxys |
| Citations |
|---|