EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43F |
| Net Charge | 0 |
| Average Mass | 386.639 |
| Monoisotopic Mass | 386.33488 |
| SMILES | [H][C@]1([C@]([H])(C)CCCC(C)C)CC[C@@]2([H])/C(=C/C=C3/C[C@@H](F)CCC3=C)CCC[C@]12C |
| InChI | InChI=1S/C27H43F/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13-/t21-,24+,25-,26+,27-/m1/s1 |
| InChIKey | MDVGYNPTLLBSNB-YRZJJWOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-fluoro-9,10-secocholesta-5,7,10(19)-triene (CHEBI:137730) is a vitamin D (CHEBI:27300) |
| Manual Xrefs | Databases |
|---|---|
| LMST03020658 | LIPID MAPS |