EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O3 |
| Net Charge | 0 |
| Average Mass | 212.289 |
| Monoisotopic Mass | 212.14124 |
| SMILES | [H]C(=O)/C=C\CCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H20O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h7,9,11H,1-6,8,10H2,(H,14,15)/b9-7- |
| InChIKey | INMKWUNQKOWGEZ-CLFYSBASSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-oxo-10Z-dodecenoic acid (CHEBI:137712) is a medium-chain fatty acid (CHEBI:59554) |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060094 | LIPID MAPS |