EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H53N6NiO14 |
| Net Charge | +1 |
| Average Mass | 924.607 |
| Monoisotopic Mass | 923.29677 |
| SMILES | C[C@@]12CC(=O)N[C@@]13C[C@H]1[C@@H](CCC(=O)O)[C@](C)(CC(N)=O)C4=[N+]1[Ni-2]15[N]6C(=CC7=[N+]1[C@H](C4)[C@@H](CC(=O)O)[C@@H]7CCC(=O)O)[C@@H](CCC(=O)O)[C@H](CC(=O)O)C6=CC(=[N+]35)[C@H]2CCC(=O)O |
| InChI | InChI=1S/C42H54N6O14.Ni/c1-40(17-32(43)49)23(5-9-36(55)56)30-16-42-41(2,18-33(50)48-42)24(6-10-37(57)58)29(47-42)14-27-21(11-38(59)60)19(3-7-34(51)52)25(44-27)13-26-20(4-8-35(53)54)22(12-39(61)62)28(45-26)15-31(40)46-30;/h13-14,19-24,28,30H,3-12,15-18H2,1-2H3,(H10,43,44,45,47,48,49,50,51,52,53,54,55,56,57,58,59,60,61,62);/q;+2/p-1/t19-,20-,21-,22-,23+,24+,28+,30-,40-,41-,42-;/m0./s1 |
| InChIKey | HHAOAZMDQIXGKF-MYQROCLPSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Methanobacterium thermoautotrophicum (ncbitaxon:145262) | - | PubMed (3691535) | |
| Methanospirillum hungatei (ncbitaxon:2203) | - | PubMed (3691535) | |
| Methanosarcina acetivorans (ncbitaxon:188937) | - | PubMed (27846569) | Strain: C2A |
| Methanobrevibacter arboriphilus (ncbitaxon:39441) | - | PubMed (3691535) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15,173-seco-F430-173-acid (CHEBI:137699) has functional parent sirohydrochlorin (CHEBI:18023) |
| 15,173-seco-F430-173-acid (CHEBI:137699) has role bacterial metabolite (CHEBI:76969) |
| 15,173-seco-F430-173-acid (CHEBI:137699) is a metalloporphyrin (CHEBI:25216) |
| 15,173-seco-F430-173-acid (CHEBI:137699) is a nickel coordination entity (CHEBI:35438) |
| 15,173-seco-F430-173-acid (CHEBI:137699) is conjugate acid of 15,173-seco-F430-173-acid(5−) (CHEBI:136888) |
| Incoming Relation(s) |
| 15,173-seco-F430-173-acid(5−) (CHEBI:136888) is conjugate base of 15,173-seco-F430-173-acid (CHEBI:137699) |
| Manual Xrefs | Databases |
|---|---|
| CPD-7592 | MetaCyc |
| Citations |
|---|