EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H28N2O6 |
| Net Charge | 0 |
| Average Mass | 320.386 |
| Monoisotopic Mass | 320.19474 |
| SMILES | NCCCOCCOCCOCCCNC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H28N2O6/c15-5-1-7-20-9-11-22-12-10-21-8-2-6-16-13(17)3-4-14(18)19/h1-12,15H2,(H,16,17)(H,18,19) |
| InChIKey | FRJNIHLOMXIQKH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-amino-15-oxo-4,7,10-trioxa-14-azaoctadecan-18-oic acid (CHEBI:137695) is a monocarboxylic acid (CHEBI:25384) |
| 1-amino-15-oxo-4,7,10-trioxa-14-azaoctadecan-18-oic acid (CHEBI:137695) is a polyether (CHEBI:46774) |
| 1-amino-15-oxo-4,7,10-trioxa-14-azaoctadecan-18-oic acid (CHEBI:137695) is a primary amino compound (CHEBI:50994) |
| 1-amino-15-oxo-4,7,10-trioxa-14-azaoctadecan-18-oic acid (CHEBI:137695) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 1-amino-15-oxo-4,7,10-trioxa-14-azaoctadecan-18-oic acid |
| Synonyms | Source |
|---|---|
| 1,13-diamino-4,7,10-trioxatridecanesuccinamic acid | ChEBI |
| 1,13-diamino-4,7,10-trioxatridecansuccinamic acid | ChEBI |
| Ttds | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18870896 | Reaxys |
| Citations |
|---|