EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O2S.2HCl |
| Net Charge | 0 |
| Average Mass | 392.352 |
| Monoisotopic Mass | 391.08880 |
| SMILES | Cc1cncc2cccc(S(=O)(=O)N3CCCNC[C@@H]3C)c12.Cl.Cl |
| InChI | InChI=1S/C16H21N3O2S.2ClH/c1-12-9-18-11-14-5-3-6-15(16(12)14)22(20,21)19-8-4-7-17-10-13(19)2;;/h3,5-6,9,11,13,17H,4,7-8,10H2,1-2H3;2*1H/t13-;;/m0../s1 |
| InChIKey | BFOPDSJOLUQULZ-GXKRWWSZSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-methyl-1-(4-methylisoquinoline-5-sulfonyl)-1,4-diazepane dihydrochloride (CHEBI:137694) has part (S)-2-methyl-1-(4-methylisoquinoline-5-sulfonyl)-1,4-diazepane(2+) (CHEBI:138382) |
| (S)-2-methyl-1-(4-methylisoquinoline-5-sulfonyl)-1,4-diazepane dihydrochloride (CHEBI:137694) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| (S)-2-methyl-1-(4-methylisoquinoline-5-sulfonyl)-1,4-diazepane dihydrochloride (CHEBI:137694) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-methyl-5-[(2S)-2-methyl-1,4-diazepane-1-sulfonyl]isoquinoline dihydrochloride |
| Synonyms | Source |
|---|---|
| dimethyl fasudil dihydrochloride | ChEBI |
| H-1152 dihydrochloride | ChEBI |
| ROCK inhibitor | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14609918 | Reaxys |
| Citations |
|---|