EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N6O |
| Net Charge | 0 |
| Average Mass | 358.405 |
| Monoisotopic Mass | 358.15421 |
| SMILES | N[C@H](Cc1cnc2ccccc12)C(=O)N/N=C/c1ccc2nccnc2c1 |
| InChI | InChI=1S/C20H18N6O/c21-16(10-14-12-24-17-4-2-1-3-15(14)17)20(27)26-25-11-13-5-6-18-19(9-13)23-8-7-22-18/h1-9,11-12,16,24H,10,21H2,(H,26,27)/b25-11+/t16-/m1/s1 |
| InChIKey | FGYHLIHEFHCMPP-FVWOBLMASA-N |
| Roles Classification |
|---|
| Biological Roles: | RhoC inhibitor Any inhibitor that interferes with the action of the protein RhoC. RhoA inhibitor Any inhibitor that interferes with the action of the protein RhoA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhosin (CHEBI:137693) has role antineoplastic agent (CHEBI:35610) |
| rhosin (CHEBI:137693) has role RhoA inhibitor (CHEBI:138380) |
| rhosin (CHEBI:137693) has role RhoC inhibitor (CHEBI:138381) |
| rhosin (CHEBI:137693) is a D-tryptophan derivative (CHEBI:47997) |
| rhosin (CHEBI:137693) is a hydrazone (CHEBI:38532) |
| rhosin (CHEBI:137693) is a quinoxaline derivative (CHEBI:38771) |
| IUPAC Name |
|---|
| (2R)-2-amino-3-(1H-indol-3-yl)-N'-[(E)-(quinoxalin-6-yl)methylidene]propanehydrazide |
| Synonyms | Source |
|---|---|
| Rho Inhibitor | SUBMITTER |
| D-tryptophan (2E)-2-(6-quinoxalinylmethylene)hydrazide | ChEBI |
| (quinoxalinylmethylidene-D-tryptophanyl)hydrazide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25133391 | Reaxys |
| Citations |
|---|