EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O4 |
| Net Charge | 0 |
| Average Mass | 184.191 |
| Monoisotopic Mass | 184.07356 |
| SMILES | O=C(O)C(=O)C[C@@H]1C=C[C@H](O)CC1 |
| InChI | InChI=1S/C9H12O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1,3,6-7,10H,2,4-5H2,(H,12,13)/t6-,7+/m1/s1 |
| InChIKey | ABMPOYCAXJZJJB-RQJHMYQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (22765234) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(1R,4R)-4-hydroxycyclohex-2-en-1-yl]pyruvic acid (CHEBI:137659) has role bacterial metabolite (CHEBI:76969) |
| 3-[(1R,4R)-4-hydroxycyclohex-2-en-1-yl]pyruvic acid (CHEBI:137659) is a tetrahydro-4-hydroxyphenylpyruvic acid (CHEBI:64808) |
| 3-[(1R,4R)-4-hydroxycyclohex-2-en-1-yl]pyruvic acid (CHEBI:137659) is conjugate acid of 3-[(1R,4R)-4-hydroxycyclohex-2-en-1-yl]pyruvate (CHEBI:136783) |
| Incoming Relation(s) |
| 3-[(1R,4R)-4-hydroxycyclohex-2-en-1-yl]pyruvate (CHEBI:136783) is conjugate base of 3-[(1R,4R)-4-hydroxycyclohex-2-en-1-yl]pyruvic acid (CHEBI:137659) |
| IUPAC Name |
|---|
| 3-[(1R,4R)-4-hydroxycyclohex-2-en-1-yl]-2-oxopropanoic acid |
| Synonyms | Source |
|---|---|
| (1R,4R)-tetrahydro-4-hydroxyphenylpyruvic acid | ChEBI |
| 4R-H4HPP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-17512 | MetaCyc |
| Citations |
|---|