EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | [H]C(=O)CCCC(N)C(=O)O |
| InChI | InChI=1S/C6H11NO3/c7-5(6(9)10)3-1-2-4-8/h4-5H,1-3,7H2,(H,9,10) |
| InChIKey | GFXYTQPNNXGICT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allysine (CHEBI:17027) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| allysine (CHEBI:17027) is tautomer of allysine zwitterion (CHEBI:57988) |
| Incoming Relation(s) |
| L-allysine (CHEBI:17917) is a allysine (CHEBI:17027) |
| allysine zwitterion (CHEBI:57988) is tautomer of allysine (CHEBI:17027) |
| IUPAC Names |
|---|
| 2-amino-6-oxohexanoic acid |
| allysine |
| Synonyms | Source |
|---|---|
| Allysine | KEGG COMPOUND |
| 2-Aminoadipate 6-semialdehyde | KEGG COMPOUND |
| 2-amino-5-formylvaleric acid | ChemIDplus |
| 6-oxonorleucine | ChemIDplus |
| α-aminoadipic acid δ-semialdehyde | ChemIDplus |
| α-aminoadipic δ-semialdehyde | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1857434 | Beilstein |
| CAS:1962-83-0 | KEGG COMPOUND |
| CAS:1962-83-0 | ChemIDplus |