EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@@]12CC/C(C)=C/CC/C(C)=C/C[C@@]1(C)CC[C@H]2C(C)(C)O |
| InChI | InChI=1S/C20H34O/c1-15-7-6-8-16(2)11-13-20(5)14-12-17(19(3,4)21)18(20)10-9-15/h7,11,17-18,21H,6,8-10,12-14H2,1-5H3/b15-7+,16-11+/t17-,18+,20+/m1/s1 |
| InChIKey | OEBBSSBZPLXOHC-HJHANVIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (27933080) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E,7E)-dolabella-3,7-dien-18-ol (CHEBI:137565) has role plant metabolite (CHEBI:76924) |
| (3E,7E)-dolabella-3,7-dien-18-ol (CHEBI:137565) is a carbobicyclic compound (CHEBI:36785) |
| (3E,7E)-dolabella-3,7-dien-18-ol (CHEBI:137565) is a diterpenoid (CHEBI:23849) |
| (3E,7E)-dolabella-3,7-dien-18-ol (CHEBI:137565) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 2-[(1R,3aR,5E,9E,12aS)-3a,6,10-trimethyl-1,2,3,3a,4,7,8,11,12,12a-decahydrocyclopenta[11]annulen-1-yl]propan-2-ol |
| Synonym | Source |
|---|---|
| (1R,3E,7E,11S,12R)-dolabella-3,7-diene-18-ol | ChEBI |
| UniProt Name | Source |
|---|---|
| (3E,7E)-dolabella-3,7-dien-18-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20109 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10284389 | Reaxys |
| Citations |
|---|