EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO3S |
| Net Charge | 0 |
| Average Mass | 205.279 |
| Monoisotopic Mass | 205.07726 |
| SMILES | CCC(=O)N[C@@H](CCSC)C(=O)O |
| InChI | InChI=1S/C8H15NO3S/c1-3-7(10)9-6(8(11)12)4-5-13-2/h6H,3-5H2,1-2H3,(H,9,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | RBAAEQRITQHPJM-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-propanoyl-L-methionine (CHEBI:137541) has functional parent propionic acid (CHEBI:30768) |
| N-propanoyl-L-methionine (CHEBI:137541) is a N-(fatty acyl)-L-α-amino acid (CHEBI:137550) |
| N-propanoyl-L-methionine (CHEBI:137541) is a L-methionine derivative (CHEBI:84121) |
| N-propanoyl-L-methionine (CHEBI:137541) is conjugate acid of N-propanoyl-L-methioninate (CHEBI:136704) |
| Incoming Relation(s) |
| N-propanoyl-L-methioninate (CHEBI:136704) is conjugate base of N-propanoyl-L-methionine (CHEBI:137541) |
| IUPAC Name |
|---|
| N-propanoyl-L-methionine |
| Synonyms | Source |
|---|---|
| N-propionyl-L-methionine | ChEBI |
| N-propionylmethionine | ChEBI |
| N-propanoylmethionine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:31035941 | Reaxys |