EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:137533 - (−)-α-amorphene
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CCC(C)=C[C@]1([H])[C@H](C(C)C)CC=C2C |
| InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h6,9-10,13-15H,5,7-8H2,1-4H3/t13-,14-,15+/m0/s1 |
| InChIKey | QMAYBMKBYCGXDH-SOUVJXGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pelargonium quercetorum (ncbitaxon:158602) | cotyledon (BTO:0000300) | PubMed (17365684) | Obtained from the essential oil |
| Sabina chinensis (ncbitaxon:50182) | leaf (BTO:0000713) | PubMed (16830472) | |
| Pinus massoniana (ncbitaxon:88730) | amniotic fluid (BTO:0000068) | Article (Journal of Xiamen University. Natural science 41, 584-588) | Obtained from the essential oil of the needles |
| Cupressus lusitanica (ncbitaxon:103968) | leaf (BTO:0000713) | PubMed (16830472) | |
| Kundmannia sicula (ncbitaxon:1094597) | aerial part (BTO:0001658) | PubMed (18463583) | Obtained from the essential oil of the aerial parts |
| Alseuosmia macrophylla (ncbitaxon:49583) | flower (BTO:0000469) | DOI (10.1080/10412905.1996.9700590) | Obtained from the essential oil of the flowers |
| Nepeta persica (IPNI:452651-1) | root (BTO:0001188) | PubMed (20433086) | Obtained from the essential oil of the roots |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-α-amorphene (CHEBI:137533) has role plant metabolite (CHEBI:76924) |
| (−)-α-amorphene (CHEBI:137533) is a cadinene (CHEBI:22976) |
| (−)-α-amorphene (CHEBI:137533) is a polycyclic olefin (CHEBI:35714) |
| IUPAC Name |
|---|
| (1S,4aR,8aS)-4,7-dimethyl-1-(propan-2-yl)-1,2,4a,5,6,8a-hexahydronaphthalene |
| UniProt Name | Source |
|---|---|
| (−)-α-amorphene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8797 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8392869 | Reaxys |
| Citations |
|---|