EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | O=C(O)CCCCCC[C@H]1C(=O)C=C[C@@H]1/C=C/[C@@H](O)CCCCCO |
| InChI | InChI=1S/C20H32O5/c21-15-7-3-4-8-17(22)13-11-16-12-14-19(23)18(16)9-5-1-2-6-10-20(24)25/h11-14,16-18,21-22H,1-10,15H2,(H,24,25)/b13-11+/t16-,17-,18+/m0/s1 |
| InChIKey | UVENTFXDEXEMMD-OLMSDWHISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxyprostaglandin A1 (CHEBI:137529) has functional parent prostaglandin A1 (CHEBI:15545) |
| 20-hydroxyprostaglandin A1 (CHEBI:137529) is a diol (CHEBI:23824) |
| 20-hydroxyprostaglandin A1 (CHEBI:137529) is a primary alcohol (CHEBI:15734) |
| 20-hydroxyprostaglandin A1 (CHEBI:137529) is a prostaglandins A (CHEBI:26334) |
| 20-hydroxyprostaglandin A1 (CHEBI:137529) is a secondary allylic alcohol (CHEBI:134396) |
| 20-hydroxyprostaglandin A1 (CHEBI:137529) is conjugate acid of 20-hydroxyprostaglandin A1(1−) (CHEBI:136663) |
| Incoming Relation(s) |
| 20-hydroxyprostaglandin A1(1−) (CHEBI:136663) is conjugate base of 20-hydroxyprostaglandin A1 (CHEBI:137529) |
| IUPAC Name |
|---|
| (13E,15S)-15,20-dihydroxy-9-oxoprosta-10,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| 20-hydroxy-PGA1 | ChEBI |
| 20-hydroxy prostaglandin A1 | ChEBI |
| 20-hydroxy-prostaglandin A1 | ChEBI |
| 20-OH-PGA1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24406267 | Reaxys |