EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@]1(O)CC(C)(C)C[C@H]1C[C@]12C |
| InChI | InChI=1S/C15H26O/c1-10-5-6-12-14(4)8-11(14)7-13(2,3)9-15(10,12)16/h10-12,16H,5-9H2,1-4H3/t10-,11+,12+,14-,15-/m1/s1 |
| InChIKey | KVFZUTBKAXAVDX-CYHVGBIXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces violaceusniger (ncbitaxon:68280) | - | PubMed (24626486) | |
| Streptomyces malaysiensis (ncbitaxon:92644) | - | PubMed (28247907) | |
| Leptopgraphium lundbergii (ncbitaxon:96373) | - | PubMed (25171145) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-isoafricanol (CHEBI:137522) has role bacterial metabolite (CHEBI:76969) |
| (+)-isoafricanol (CHEBI:137522) has role fungal metabolite (CHEBI:76946) |
| (+)-isoafricanol (CHEBI:137522) is a carbotricyclic compound (CHEBI:38032) |
| (+)-isoafricanol (CHEBI:137522) is a sesquiterpenoid (CHEBI:26658) |
| (+)-isoafricanol (CHEBI:137522) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1aS,4aR,5R,7aS,7bR)-3,3,5,7b-tetramethyldecahydro-4aH-cyclopropa[e]azulen-4a-ol |
| Synonym | Source |
|---|---|
| Isoafricanol | KNApSAcK |
| UniProt Name | Source |
|---|---|
| (+)-isoafricanol | UniProt |
| Citations |
|---|