EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O3 |
| Net Charge | 0 |
| Average Mass | 194.230 |
| Monoisotopic Mass | 194.09429 |
| SMILES | O=C(O)CCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C11H14O3/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h5-8,12H,1-4H2,(H,13,14) |
| InChIKey | YSSJQFONKASLKM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(4-hydroxyphenyl)pentanoic acid (CHEBI:137518) is a medium-chain fatty acid (CHEBI:59554) |
| Manual Xrefs | Databases |
|---|---|
| 5379435 | ChemSpider |
| HMDB0132270 | HMDB |