EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29O5 |
| Net Charge | -1 |
| Average Mass | 373.469 |
| Monoisotopic Mass | 373.20205 |
| SMILES | CC/C=C\C[C@H](O)C(=O)/C=C/C=C/C=C\C=C\[C@@H](O)C/C=C\CCC(=O)[O-] |
| InChI | InChI=1S/C22H30O5/c1-2-3-9-16-20(24)21(25)17-12-7-5-4-6-10-14-19(23)15-11-8-13-18-22(26)27/h3-12,14,17,19-20,23-24H,2,13,15-16,18H2,1H3,(H,26,27)/p-1/b6-4-,7-5+,9-3-,11-8-,14-10+,17-12+/t19-,20+/m1/s1 |
| InChIKey | CTWAHHIYDLSAPS-UHJGEWICSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-oxoresolvin D2(1−) (CHEBI:137498) is a docosanoid anion (CHEBI:131864) |
| 16-oxoresolvin D2(1−) (CHEBI:137498) is a hydroxy fatty acid anion (CHEBI:59835) |
| 16-oxoresolvin D2(1−) (CHEBI:137498) is a long-chain fatty acid anion (CHEBI:57560) |
| 16-oxoresolvin D2(1−) (CHEBI:137498) is a oxo fatty acid anion (CHEBI:59836) |
| 16-oxoresolvin D2(1−) (CHEBI:137498) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| 16-oxoresolvin D2(1−) (CHEBI:137498) is conjugate base of 16-oxoresolvin D2 (CHEBI:138281) |
| Incoming Relation(s) |
| 16-oxoresolvin D2 (CHEBI:138281) is conjugate acid of 16-oxoresolvin D2(1−) (CHEBI:137498) |
| IUPAC Name |
|---|
| (4Z,7S,8E,10Z,12E,14E,17S,19Z)-7,17-dihydroxy-16-oxodocosa-4,8,10,12,14,19-hexaenoate |
| Synonyms | Source |
|---|---|
| (7S,17S)-dihydroxy-16-oxo-(4Z,8E,10Z,12E,14E,19Z)-docosahexaenoate | SUBMITTER |
| 16-oxo-RvD2(1−) | SUBMITTER |
| (4Z,7S,8E,10Z,12E,14E,17S,19Z)-7,17-dihydroxy-16-oxodocosahexaenoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 16-oxoresolvin D2 | UniProt |
| Citations |
|---|