EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O3 |
| Net Charge | 0 |
| Average Mass | 296.451 |
| Monoisotopic Mass | 296.23514 |
| SMILES | CCCCC[C@@H](O)/C=C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O3/c1-2-3-11-14-17(19)15-12-9-7-5-4-6-8-10-13-16-18(20)21/h7,9,12,15,17,19H,2-6,8,10-11,13-14,16H2,1H3,(H,20,21)/b9-7-,15-12+/t17-/m1/s1 |
| InChIKey | HNICUWMFWZBIFP-PIHGWCCBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13(R)-HODE (CHEBI:137495) is a 13-HODE (CHEBI:72639) |
| 13(R)-HODE (CHEBI:137495) is conjugate acid of 13(R)-HODE(1−) (CHEBI:136655) |
| Incoming Relation(s) |
| 13(R)-HODE(1−) (CHEBI:136655) is conjugate base of 13(R)-HODE (CHEBI:137495) |
| IUPAC Name |
|---|
| (9Z,11E,13R)-13-hydroxyoctadeca-9,11-dienoic acid |
| Synonyms | Source |
|---|---|
| (13R)-HODE | ChEBI |
| (13R)-hydroxy-(9Z,11E)-octadecadienoic acid | ChEBI |
| (9Z,11E,13R)-13-hydroxyoctadecadienoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4316130 | Reaxys |
| CAS:10219-69-9 | ChemIDplus |