EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O9 |
| Net Charge | 0 |
| Average Mass | 462.495 |
| Monoisotopic Mass | 462.18898 |
| SMILES | [H][C@@]12C[C@@H](O)C(=O)[C@@]1(C)CC[C@]1([H])c3ccc(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C24H30O9/c1-24-7-6-13-12-5-3-11(32-23-19(28)17(26)18(27)20(33-23)22(30)31)8-10(12)2-4-14(13)15(24)9-16(25)21(24)29/h3,5,8,13-20,23,25-28H,2,4,6-7,9H2,1H3,(H,30,31)/t13-,14-,15+,16-,17+,18+,19-,20+,23-,24+/m1/s1 |
| InChIKey | LUVBXKQCOJYEJY-OWYKRJLGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16α-hydroxyestrone 3-O-(β-D-glucuronide) (CHEBI:137488) has functional parent 16α-hydroxyestrone (CHEBI:776) |
| 16α-hydroxyestrone 3-O-(β-D-glucuronide) (CHEBI:137488) is a 16α-hydroxy steroid (CHEBI:16799) |
| 16α-hydroxyestrone 3-O-(β-D-glucuronide) (CHEBI:137488) is a 17-oxo steroid (CHEBI:19168) |
| 16α-hydroxyestrone 3-O-(β-D-glucuronide) (CHEBI:137488) is a secondary α-hydroxy ketone (CHEBI:2468) |
| 16α-hydroxyestrone 3-O-(β-D-glucuronide) (CHEBI:137488) is a steroid glucosiduronic acid (CHEBI:26763) |
| 16α-hydroxyestrone 3-O-(β-D-glucuronide) (CHEBI:137488) is a β-D-glucosiduronic acid (CHEBI:15341) |
| 16α-hydroxyestrone 3-O-(β-D-glucuronide) (CHEBI:137488) is conjugate acid of 16α-hydroxyestrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136635) |
| Incoming Relation(s) |
| 16α-hydroxyestrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136635) is conjugate base of 16α-hydroxyestrone 3-O-(β-D-glucuronide) (CHEBI:137488) |
| IUPAC Name |
|---|
| 16α-hydroxy-17-oxoestra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28631358 | Reaxys |
| Citations |
|---|