EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O5 |
| Net Charge | 0 |
| Average Mass | 134.087 |
| Monoisotopic Mass | 134.02152 |
| SMILES | O=C(O)C(=O)[C@@H](O)CO |
| InChI | InChI=1S/C4H6O5/c5-1-2(6)3(7)4(8)9/h2,5-6H,1H2,(H,8,9)/t2-/m0/s1 |
| InChIKey | CODPBKJMVNZFKR-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3,4-dihydroxy-2-oxobutanoic acid (CHEBI:137456) has functional parent butyric acid (CHEBI:30772) |
| (S)-3,4-dihydroxy-2-oxobutanoic acid (CHEBI:137456) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| (S)-3,4-dihydroxy-2-oxobutanoic acid (CHEBI:137456) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (S)-3,4-dihydroxy-2-oxobutanoic acid (CHEBI:137456) is a ketoaldonic acid (CHEBI:24963) |
| (S)-3,4-dihydroxy-2-oxobutanoic acid (CHEBI:137456) is a secondary α-hydroxy ketone (CHEBI:2468) |
| (S)-3,4-dihydroxy-2-oxobutanoic acid (CHEBI:137456) is conjugate acid of (S)-3,4-dihydroxy-2-oxobutanoate (CHEBI:136669) |
| (S)-3,4-dihydroxy-2-oxobutanoic acid (CHEBI:137456) is enantiomer of (R)-3,4-dihydroxy-2-oxobutanoic acid (CHEBI:137486) |
| Incoming Relation(s) |
| (S)-3,4-dihydroxy-2-oxobutanoate (CHEBI:136669) is conjugate base of (S)-3,4-dihydroxy-2-oxobutanoic acid (CHEBI:137456) |
| (R)-3,4-dihydroxy-2-oxobutanoic acid (CHEBI:137486) is enantiomer of (S)-3,4-dihydroxy-2-oxobutanoic acid (CHEBI:137456) |
| IUPAC Name |
|---|
| (3S)-3,4-dihydroxy-2-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 2-dehydro-L-erythronic acid | ChEBI |
| 2-dehydro-L-threonic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-19882 | MetaCyc |