EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO2 |
| Net Charge | 0 |
| Average Mass | 285.387 |
| Monoisotopic Mass | 285.17288 |
| SMILES | CCCCCCC/C=C/c1cc(=O)c2ccccc2n1O |
| InChI | InChI=1S/C18H23NO2/c1-2-3-4-5-6-7-8-11-15-14-18(20)16-12-9-10-13-17(16)19(15)21/h8-14,21H,2-7H2,1H3/b11-8+ |
| InChIKey | LOUOCBKBIWBTTR-DHZHZOJOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas aeruginosa PAO1 (ncbitaxon:208964) | - | PubMed (28523838) | Strain: PAO1 |
| Pseudomonas aeruginosa PA14 (ncbitaxon:652611) | - | PubMed (28523838) | Strain: PA14 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-1-hydroxy-2-(non-1-en-1-yl)quinolin-4-one (CHEBI:137441) has role antibacterial agent (CHEBI:33282) |
| (E)-1-hydroxy-2-(non-1-en-1-yl)quinolin-4-one (CHEBI:137441) has role bacterial metabolite (CHEBI:76969) |
| (E)-1-hydroxy-2-(non-1-en-1-yl)quinolin-4-one (CHEBI:137441) is a hydroxylamines (CHEBI:24709) |
| (E)-1-hydroxy-2-(non-1-en-1-yl)quinolin-4-one (CHEBI:137441) is a olefinic compound (CHEBI:78840) |
| (E)-1-hydroxy-2-(non-1-en-1-yl)quinolin-4-one (CHEBI:137441) is a organic heterobicyclic compound (CHEBI:27171) |
| (E)-1-hydroxy-2-(non-1-en-1-yl)quinolin-4-one (CHEBI:137441) is a quinolone (CHEBI:23765) |
| IUPAC Name |
|---|
| 1-hydroxy-2-[(1E)-non-1-en-1-yl]quinolin-4(1H)-one |
| Synonym | Source |
|---|---|
| trans-N-hydroxy-Δ1-2-(non-1-enyl)-4-quinolone | ChEBI |
| Citations |
|---|