EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3S |
| Net Charge | 0 |
| Average Mass | 162.210 |
| Monoisotopic Mass | 162.03507 |
| SMILES | CC(=O)SC[C@H](C)C(=O)O |
| InChI | InChI=1S/C6H10O3S/c1-4(6(8)9)3-10-5(2)7/h4H,3H2,1-2H3,(H,8,9)/t4-/m0/s1 |
| InChIKey | VFVHNRJEYQGRGE-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-(acetylthio)isobutyric acid (CHEBI:137433) is a monocarboxylic acid (CHEBI:25384) |
| (R)-3-(acetylthio)isobutyric acid (CHEBI:137433) is a thioacetate ester (CHEBI:52477) |
| IUPAC Name |
|---|
| (2R)-3-(acetylthio)-2-methylpropanoic acid |
| Synonyms | Source |
|---|---|
| DAT | SUBMITTER |
| (2R)-3-(acetylthio)isobutyric acid | ChEBI |
| (R)-3-(acetylthio)-2-methylpropanoic acid | ChEBI |
| D-β-acetylthioisobutyric acid | ChEBI |
| (R)-3-(acetylthio)-2-methylpropionic acid | ChemIDplus |
| (R)-3-acetylthioisobutyric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5729494 | Reaxys |
| CAS:74431-52-0 | ChemIDplus |
| Citations |
|---|