EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | CC(=O)C1C(=O)C=C(C)OC1=O |
| InChI | InChI=1S/C8H8O4/c1-4-3-6(10)7(5(2)9)8(11)12-4/h3,7H,1-2H3 |
| InChIKey | PGRHXDWITVMQBC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | fungicide A substance used to destroy fungal pests. plasticiser Any compound that is used as an additive to increase the plasticity or fluidity of a substance, particularly but not exclusively to synthetic polymers. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydroacetic acid (CHEBI:137426) has role antibacterial agent (CHEBI:33282) |
| dehydroacetic acid (CHEBI:137426) has role fungicide (CHEBI:24127) |
| dehydroacetic acid (CHEBI:137426) has role plasticiser (CHEBI:79056) |
| dehydroacetic acid (CHEBI:137426) is a ketone (CHEBI:17087) |
| dehydroacetic acid (CHEBI:137426) is a pyran-2,4-dione (CHEBI:137428) |
| IUPAC Name |
|---|
| 3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione |
| Synonyms | Source |
|---|---|
| Biocide 470F | ChemIDplus |
| Methylacetopyronone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| AU2004287448 | Patent |
| Dehydroacetic_acid | Wikipedia |
| US3849579 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:520-45-6 | ChemIDplus |
| Citations |
|---|