EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23NO4 |
| Net Charge | 0 |
| Average Mass | 245.319 |
| Monoisotopic Mass | 245.16271 |
| SMILES | [H][C@@](CCCCCCC)(CC(=O)O)NCC(=O)O |
| InChI | InChI=1S/C12H23NO4/c1-2-3-4-5-6-7-10(8-11(14)15)13-9-12(16)17/h10,13H,2-9H2,1H3,(H,14,15)(H,16,17)/t10-/m1/s1 |
| InChIKey | DKLSSPDDVJYWNG-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3-[(carboxymethyl)amino]decanoic acid (CHEBI:137421) is a α-amino acid (CHEBI:33704) |