EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:137416 - (3R)-3-[(carboxymethyl)amino]butanoic acid
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | C[C@H](CC(=O)O)NCC(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-4(2-5(8)9)7-3-6(10)11/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11)/t4-/m1/s1 |
| InChIKey | VRGLRLBEHJTRMK-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3-[(carboxymethyl)amino]butanoic acid (CHEBI:137416) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (3R)-3-[(carboxymethyl)amino]butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 7UC | PDBeChem |
| Citations |
|---|