EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6O5S |
| Net Charge | 0 |
| Average Mass | 238.220 |
| Monoisotopic Mass | 237.99359 |
| SMILES | O=C1C=C(S(=O)(=O)O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H6O5S/c11-8-5-9(16(13,14)15)6-3-1-2-4-7(6)10(8)12/h1-5H,(H,13,14,15) |
| InChIKey | PZTGRDMCBZUJDL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | colorimetric reagent A reagent used in the determination of the concentration of a coloured chemical element or chemical compound in solution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-naphthoquinone-4-sulfonic acid (CHEBI:137378) has role colorimetric reagent (CHEBI:67126) |
| 1,2-naphthoquinone-4-sulfonic acid (CHEBI:137378) is a arenesulfonic acid (CHEBI:33555) |
| 1,2-naphthoquinone-4-sulfonic acid (CHEBI:137378) is a naphthalenone (CHEBI:25479) |
| IUPAC Name |
|---|
| 3,4-dioxo-3,4-dihydronaphthalene-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| 3,4-dihydro-3,4-dioxonaphthalene-1-sulphonic acid | ChemIDplus |
| 3,4-dihydro-3,4-dioxo-1-naphthalenesulfonic acid | ChemIDplus |
| 1,2-naphthoquinone-4-sulphonic acid | ChEBI |
| β-naphthoquinone-4-sulfonic acid | ChEBI |
| Citations |
|---|