EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9ClN2O3 |
| Net Charge | 0 |
| Average Mass | 264.668 |
| Monoisotopic Mass | 264.03017 |
| SMILES | Nc1c([N+](=O)[O-])ccc(Oc2ccccc2)c1Cl |
| InChI | InChI=1S/C12H9ClN2O3/c13-11-10(18-8-4-2-1-3-5-8)7-6-9(12(11)14)15(16)17/h1-7H,14H2 |
| InChIKey | DDBMQDADIHOWIC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aclonifen (CHEBI:137374) has role agrochemical (CHEBI:33286) |
| aclonifen (CHEBI:137374) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| aclonifen (CHEBI:137374) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| aclonifen (CHEBI:137374) has role herbicide (CHEBI:24527) |
| aclonifen (CHEBI:137374) is a C-nitro compound (CHEBI:35716) |
| aclonifen (CHEBI:137374) is a aromatic ether (CHEBI:35618) |
| aclonifen (CHEBI:137374) is a monochlorobenzenes (CHEBI:83403) |
| aclonifen (CHEBI:137374) is a primary amino compound (CHEBI:50994) |
| aclonifen (CHEBI:137374) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-chloro-6-nitro-3-phenoxyaniline |
| Synonyms | Source |
|---|---|
| 2-chloro-6-nitro-3-phenoxybenzenamine | Alan Wood's Pesticides |
| aclonifène | ChEBI |
| Brand Name | Source |
|---|---|
| Bandur | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8321574 | Reaxys |
| CAS:74070-46-5 | Alan Wood's Pesticides |
| CAS:74070-46-5 | ChemIDplus |
| Citations |
|---|