EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O8P |
| Net Charge | 0 |
| Average Mass | 228.093 |
| Monoisotopic Mass | 228.00350 |
| SMILES | O=C(O)C[C@](O)(CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C5H9O8P/c6-3(7)1-5(10,4(8)9)2-14(11,12)13/h10H,1-2H2,(H,6,7)(H,8,9)(H2,11,12,13)/t5-/m0/s1 |
| InChIKey | PHYKLCHCKYTLRX-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-(phosphonomethyl)malic acid (CHEBI:137343) has functional parent succinic acid (CHEBI:15741) |
| (R)-2-(phosphonomethyl)malic acid (CHEBI:137343) is a dicarboxylic acid (CHEBI:35692) |
| (R)-2-(phosphonomethyl)malic acid (CHEBI:137343) is a hydroxy carboxylic acid (CHEBI:24669) |
| (R)-2-(phosphonomethyl)malic acid (CHEBI:137343) is a phosphonic acids (CHEBI:26069) |
| (R)-2-(phosphonomethyl)malic acid (CHEBI:137343) is a tertiary alcohol (CHEBI:26878) |
| (R)-2-(phosphonomethyl)malic acid (CHEBI:137343) is conjugate acid of (R)-2-(phosphonomethyl)malate(3−) (CHEBI:136541) |
| Incoming Relation(s) |
| (R)-2-(phosphonomethyl)malate(3−) (CHEBI:136541) is conjugate base of (R)-2-(phosphonomethyl)malic acid (CHEBI:137343) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-2-(phosphonomethyl)butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-15963 | MetaCyc |
| Citations |
|---|