EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H38N4O4 |
| Net Charge | 0 |
| Average Mass | 578.713 |
| Monoisotopic Mass | 578.28931 |
| SMILES | C=CC1=C(C)C(C=C)N=C1/C=c1\n/c(=C\C2=N/C(=C\c3ncc(C=C)c3C)C(C)=C2CCC(=O)O)c(CCC(=O)O)c1C |
| InChI | InChI=1S/C35H38N4O4/c1-8-23-18-36-28(19(23)4)15-29-21(6)25(11-13-34(40)41)32(38-29)17-33-26(12-14-35(42)43)22(7)30(39-33)16-31-24(9-2)20(5)27(10-3)37-31/h8-10,15-18,27,36,39H,1-3,11-14H2,4-7H3,(H,40,41)(H,42,43)/b29-15-,30-16-,33-17- |
| InChIKey | XCXDCXFCDADSKR-VTRMHZAASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anaerobilin (CHEBI:137333) is a dicarboxylic acid (CHEBI:35692) |
| anaerobilin (CHEBI:137333) is a linear tetrapyrrole (CHEBI:25046) |
| anaerobilin (CHEBI:137333) is tautomer of anaerobilin dizwitterion (CHEBI:136517) |
| Incoming Relation(s) |
| anaerobilin dizwitterion (CHEBI:136517) is tautomer of anaerobilin (CHEBI:137333) |
| Manual Xrefs | Databases |
|---|---|
| CPD-19710 | MetaCyc |
| Citations |
|---|