EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H34N4O6 |
| Net Charge | 0 |
| Average Mass | 582.657 |
| Monoisotopic Mass | 582.24783 |
| SMILES | C=CC1=C(C)/C(=C/c2nc(/C=C3\N=C(/C=C4\NC(=O)C(C)=C4CCC(=O)O)C(CCC(=O)O)=C3C)c(C)c2C=C)NC1=O |
| InChI | InChI=1S/C33H34N4O6/c1-7-20-16(3)24(34-27(20)14-26-17(4)21(8-2)33(43)36-26)13-25-18(5)22(9-11-30(38)39)28(35-25)15-29-23(10-12-31(40)41)19(6)32(42)37-29/h7-8,13-15,34H,1-2,9-12H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b25-13-,26-14-,29-15- |
| InChIKey | TXGRNAAVTFLEFF-IONLHYSMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biliverdin β (CHEBI:137298) is a dicarboxylic acid (CHEBI:35692) |
| biliverdin β (CHEBI:137298) is a linear tetrapyrrole (CHEBI:25046) |
| biliverdin β (CHEBI:137298) is conjugate acid of biliverdin β(2−) (CHEBI:136509) |
| Incoming Relation(s) |
| biliverdin β(2−) (CHEBI:136509) is conjugate base of biliverdin β (CHEBI:137298) |
| Synonym | Source |
|---|---|
| biliverdin IX-β | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-19713 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8964274 | Reaxys |
| Citations |
|---|