EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H34N4O7 |
| Net Charge | 0 |
| Average Mass | 610.667 |
| Monoisotopic Mass | 610.24275 |
| SMILES | C=CC1=C(C)C(=O)N/C1=C\c1nc(/C=C2\N=C(C(=O)c3nc(C=O)c(C=C)c3C)C(C)=C2CCC(=O)O)c(CCC(=O)O)c1C |
| InChI | InChI=1S/C34H34N4O7/c1-7-20-17(4)31(37-28(20)15-39)33(44)32-18(5)23(10-12-30(42)43)27(36-32)14-26-22(9-11-29(40)41)16(3)24(35-26)13-25-21(8-2)19(6)34(45)38-25/h7-8,13-15,35,37H,1-2,9-12H2,3-6H3,(H,38,45)(H,40,41)(H,42,43)/b25-13-,27-14- |
| InChIKey | LMLDNIVBTHTSFX-POPOVHIPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mycobilin b (CHEBI:137297) is a arenecarbaldehyde (CHEBI:33855) |
| mycobilin b (CHEBI:137297) is a aromatic ketone (CHEBI:76224) |
| mycobilin b (CHEBI:137297) is a dicarboxylic acid (CHEBI:35692) |
| mycobilin b (CHEBI:137297) is a linear tetrapyrrole (CHEBI:25046) |
| mycobilin b (CHEBI:137297) is conjugate acid of mycobilin b(2−) (CHEBI:136508) |
| Incoming Relation(s) |
| mycobilin b(2−) (CHEBI:136508) is conjugate base of mycobilin b (CHEBI:137297) |
| Manual Xrefs | Databases |
|---|---|
| CPD-19715 | MetaCyc |
| Citations |
|---|