EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3S |
| Net Charge | 0 |
| Average Mass | 151.187 |
| Monoisotopic Mass | 151.03031 |
| SMILES | CS(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C4H9NO3S/c1-9(8)2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
| InChIKey | ZZLHPCSGGOGHFW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methiin (CHEBI:137271) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 3-(methanesulfinyl)alanine |
| Manual Xrefs | Databases |
|---|---|
| 74136 | ChemSpider |
| HMDB0029432 | HMDB |