EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (CH2)n.C10H19NO9S3 |
| Net Charge | 0 |
| Average Mass | 407.488 |
| Monoisotopic Mass | 407.03784 |
| SMILES | CSCCC/C(=N/OS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21NO9S3/c1-22-4-2-3-7(12-21-24(17,18)19)23-11-10(16)9(15)8(14)6(5-13)20-11/h6,8-11,13-16H,2-5H2,1H3,(H,17,18,19)/b12-7-/t6-,8-,9+,10-,11+/m1/s1 |
| InChIKey | ZCZCVJVUJGULMO-IIPHORNXSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ω-[(methylsulfanyl)alkyl]glucosinolic acid (CHEBI:137257) is a thia-alkylglucosinolic acid (CHEBI:79322) |
| ω-[(methylsulfanyl)alkyl]glucosinolic acid (CHEBI:137257) is conjugate acid of ω-[(methylsulfanyl)alkyl]glucosinolate (CHEBI:136434) |
| Incoming Relation(s) |
| ω-[(methylsulfanyl)alkyl]glucosinolate (CHEBI:136434) is conjugate base of ω-[(methylsulfanyl)alkyl]glucosinolic acid (CHEBI:137257) |
| Synonym | Source |
|---|---|
| ω-[(methylsulfanyl)alkyl]glucosinolic acids | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Aliphatic-glucosinolates | MetaCyc |