EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N4O4 |
| Net Charge | 0 |
| Average Mass | 388.468 |
| Monoisotopic Mass | 388.21106 |
| SMILES | CNC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@@H](CC(=O)NO)CC(C)C |
| InChI | InChI=1S/C20H28N4O4/c1-12(2)8-13(10-18(25)24-28)19(26)23-17(20(27)21-3)9-14-11-22-16-7-5-4-6-15(14)16/h4-7,11-13,17,22,28H,8-10H2,1-3H3,(H,21,27)(H,23,26)(H,24,25)/t13-,17+/m1/s1 |
| InChIKey | NITYDPDXAAFEIT-DYVFJYSZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 3.4.24.24 (gelatinase A) inhibitor An EC 3.4.24.* (metalloendopeptidase) inhibitor that interferes with the action of gelatinase A (EC 3.4.24.24). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ilomastat (CHEBI:137236) has role anti-inflammatory agent (CHEBI:67079) |
| ilomastat (CHEBI:137236) has role antibacterial agent (CHEBI:33282) |
| ilomastat (CHEBI:137236) has role antineoplastic agent (CHEBI:35610) |
| ilomastat (CHEBI:137236) has role EC 3.4.24.24 (gelatinase A) inhibitor (CHEBI:84036) |
| ilomastat (CHEBI:137236) has role neuroprotective agent (CHEBI:63726) |
| ilomastat (CHEBI:137236) is a N-acyl-amino acid (CHEBI:51569) |
| ilomastat (CHEBI:137236) is a L-tryptophan derivative (CHEBI:47994) |
| ilomastat (CHEBI:137236) is a hydroxamic acid (CHEBI:24650) |
| IUPAC Name |
|---|
| (2R)-N4-hydroxy-N1-[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide |
| INN | Source |
|---|---|
| ilomastat | KEGG DRUG |
| Synonyms | Source |
|---|---|
| CS 610 | ChemIDplus |
| galardin | SUBMITTER |
| GM 6001 | ChEBI |
| GM-6001 | ChEBI |
| GM6001 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7982373 | Reaxys |
| CAS:142880-36-2 | KEGG DRUG |
| CAS:142880-36-2 | ChemIDplus |
| Citations |
|---|