EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO2 |
| Net Charge | 0 |
| Average Mass | 113.116 |
| Monoisotopic Mass | 113.04768 |
| SMILES | O=C(O)C1CCC=N1 |
| InChI | InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h3-4H,1-2H2,(H,7,8) |
| InChIKey | DWAKNKKXGALPNW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-pyrroline-5-carboxylic acid (CHEBI:1372) is a 1-pyrrolinecarboxylic acid (CHEBI:19098) |
| 1-pyrroline-5-carboxylic acid (CHEBI:1372) is conjugate acid of 1-pyrroline-5-carboxylate (CHEBI:15893) |
| Incoming Relation(s) |
| (R)-1-pyrroline-5-carboxylic acid (CHEBI:36750) is a 1-pyrroline-5-carboxylic acid (CHEBI:1372) |
| (S)-1-pyrroline-5-carboxylic acid (CHEBI:371) is a 1-pyrroline-5-carboxylic acid (CHEBI:1372) |
| 1-pyrroline-5-carboxylate (CHEBI:15893) is conjugate base of 1-pyrroline-5-carboxylic acid (CHEBI:1372) |
| IUPAC Name |
|---|
| 3,4-dihydro-2H-pyrrole-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 3,4-Dihydro-2H-Pyrrole-2-carboxylate | KEGG COMPOUND |
| Δ1-pyrroline-5-carboxylic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C04322 | KEGG COMPOUND |
| HMDB0001301 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:111941 | Reaxys |
| CAS:2906-39-0 | ChemIDplus |